C15H28O4Si — CID 23659008
[(1R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclohept-2-en-1-yl] acetate (PubChem CID 23659008) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is [(1R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclohept-2-en-1-yl] acetate.
| Compound Name | [(1R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclohept-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 23659008 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [(1R,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxycyclohept-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H28O4Si/c1-11(16)18-13-8-7-12(17)9-14(10-13)19-20(5,6)15(2,3)4/h7-8,12-14,17H,9-10H2,1-6H3/t12-,13+,14-/m1/s1 |
| InChIKey | WWEKUKRRRZMPEY-HZSPNIEDSA-N |
| XLogP | 3.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|