C25H40O6Si — CID 25208610
[(2E,3S,5S)-3-acetyloxy-2-(2-hydroxyethylidene)-10-methyl-6-methylidene-5-triethylsilyloxyundec-9-en-7-ynyl] acetate (PubChem CID 25208610) has the molecular formula C25H40O6Si and a molecular weight of 464.68 g/mol. Its IUPAC name is [(2E,3S,5S)-3-acetyloxy-2-(2-hydroxyethylidene)-10-methyl-6-methylidene-5-triethylsilyloxyundec-9-en-7-ynyl] acetate.
| Compound Name | [(2E,3S,5S)-3-acetyloxy-2-(2-hydroxyethylidene)-10-methyl-6-methylidene-5-triethylsilyloxyundec-9-en-7-ynyl] acetate |
|---|---|
| PubChem CID | 25208610 |
| Molecular Formula | C25H40O6Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [(2E,3S,5S)-3-acetyloxy-2-(2-hydroxyethylidene)-10-methyl-6-methylidene-5-triethylsilyloxyundec-9-en-7-ynyl] acetate |
| SMILES | C=C(C#CC=C(C)C)[C@H](C[C@H](OC(C)=O)/C(=C/CO)COC(C)=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H40O6Si/c1-9-32(10-2,11-3)31-24(20(6)14-12-13-19(4)5)17-25(30-22(8)28)23(15-16-26)18-29-21(7)27/h13,15,24-26H,6,9-11,16-18H2,1-5,7-8H3/b23-15+/t24-,25-/m0/s1 |
| InChIKey | OXYIRFUFSGPAQQ-ZMBOCJRHSA-N |
| XLogP | 4.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|