C31H54O6Si2 — CID 25208643
[(2E,3S,5S)-3-acetyloxy-10-methyl-6-methylidene-5-triethylsilyloxy-2-(2-triethylsilyloxyethylidene)undec-9-en-7-ynyl] acetate (PubChem CID 25208643) has the molecular formula C31H54O6Si2 and a molecular weight of 578.94 g/mol. Its IUPAC name is [(2E,3S,5S)-3-acetyloxy-10-methyl-6-methylidene-5-triethylsilyloxy-2-(2-triethylsilyloxyethylidene)undec-9-en-7-ynyl] acetate.
| Compound Name | [(2E,3S,5S)-3-acetyloxy-10-methyl-6-methylidene-5-triethylsilyloxy-2-(2-triethylsilyloxyethylidene)undec-9-en-7-ynyl] acetate |
|---|---|
| PubChem CID | 25208643 |
| Molecular Formula | C31H54O6Si2 |
| Molecular Weight | 578.94 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | [(2E,3S,5S)-3-acetyloxy-10-methyl-6-methylidene-5-triethylsilyloxy-2-(2-triethylsilyloxyethylidene)undec-9-en-7-ynyl] acetate |
| SMILES | C=C(C#CC=C(C)C)[C@H](C[C@H](OC(C)=O)/C(=C/CO[Si](CC)(CC)CC)COC(C)=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H54O6Si2/c1-12-38(13-2,14-3)35-22-21-29(24-34-27(10)32)31(36-28(11)33)23-30(26(9)20-18-19-25(7)8)37-39(15-4,16-5)17-6/h19,21,30-31H,9,12-17,22-24H2,1-8,10-11H3/b29-21+/t30-,31-/m0/s1 |
| InChIKey | UZGLPHLZMFZCRK-WBOBDVGOSA-N |
| XLogP | 7.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.94 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|