C37H56O6Si — CID 90864726
11-[tert-butyl(dimethyl)silyl]oxy-7-[2-methoxy-4-(4-methyl-3,6-dihydro-2H-pyran-2-yl)but-3-enyl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one (PubChem CID 90864726) has the molecular formula C37H56O6Si and a molecular weight of 624.94 g/mol. Its IUPAC name is 11-[tert-butyl(dimethyl)silyl]oxy-7-[2-methoxy-4-(4-methyl-3,6-dihydro-2H-pyran-2-yl)but-3-enyl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one.
| Compound Name | 11-[tert-butyl(dimethyl)silyl]oxy-7-[2-methoxy-4-(4-methyl-3,6-dihydro-2H-pyran-2-yl)but-3-enyl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
|---|---|
| PubChem CID | 90864726 |
| Molecular Formula | C37H56O6Si |
| Molecular Weight | 624.94 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | 11-[tert-butyl(dimethyl)silyl]oxy-7-[2-methoxy-4-(4-methyl-3,6-dihydro-2H-pyran-2-yl)but-3-enyl]-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
| SMILES | C=C1CCCC2CC=CC(CC#CC(=O)OC(CC(C=CC3CC(C)=CCO3)OC)CC=CC(O[Si](C)(C)C(C)(C)C)C1)O2 |
| InChI | InChI=1S/C37H56O6Si/c1-28-13-9-14-30-15-10-16-31(41-30)17-12-20-36(38)42-34(18-11-19-35(26-28)43-44(7,8)37(3,4)5)27-32(39-6)21-22-33-25-29(2)23-24-40-33/h10-11,16,19,21-23,30-35H,1,9,13-15,17-18,24-27H2,2-8H3 |
| InChIKey | VPODICKIZCUUAJ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.94 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|