C24H48O3Si3 — CID 11070687
3-[[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy]prop-1-ynyl-trimethylsilane (PubChem CID 11070687) has the molecular formula C24H48O3Si3 and a molecular weight of 468.90 g/mol. Its IUPAC name is 3-[[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy]prop-1-ynyl-trimethylsilane.
| Compound Name | 3-[[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy]prop-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 11070687 |
| Molecular Formula | C24H48O3Si3 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 3-[[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy]prop-1-ynyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C=C1COCC#C[Si](C)(C)C |
| InChI | InChI=1S/C24H48O3Si3/c1-23(2,3)29(10,11)26-21-17-20(19-25-15-14-16-28(7,8)9)22(18-21)27-30(12,13)24(4,5)6/h17,21-22H,15,18-19H2,1-13H3/t21-,22-/m0/s1 |
| InChIKey | KYOMYNZRPCNPSN-VXKWHMMOSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|