C22H42O4Si2 — CID 139787655
tert-butyl-[(1R)-4-(1-ethoxyethoxy)-3-(3-trimethylsilylprop-2-ynoxymethyl)cyclopent-2-en-1-yl]oxy-dimethylsilane (PubChem CID 139787655) has the molecular formula C22H42O4Si2 and a molecular weight of 426.75 g/mol. Its IUPAC name is tert-butyl-[(1R)-4-(1-ethoxyethoxy)-3-(3-trimethylsilylprop-2-ynoxymethyl)cyclopent-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-4-(1-ethoxyethoxy)-3-(3-trimethylsilylprop-2-ynoxymethyl)cyclopent-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 139787655 |
| Molecular Formula | C22H42O4Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | tert-butyl-[(1R)-4-(1-ethoxyethoxy)-3-(3-trimethylsilylprop-2-ynoxymethyl)cyclopent-2-en-1-yl]oxy-dimethylsilane |
| SMILES | CCOC(C)OC1C[C@@H](O[Si](C)(C)C(C)(C)C)C=C1COCC#C[Si](C)(C)C |
| InChI | InChI=1S/C22H42O4Si2/c1-11-24-18(2)25-21-16-20(26-28(9,10)22(3,4)5)15-19(21)17-23-13-12-14-27(6,7)8/h15,18,20-21H,11,13,16-17H2,1-10H3/t18?,20-,21?/m0/s1 |
| InChIKey | XBWROLWFDKOOIG-CKHPTIKVSA-N |
| XLogP | 5.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|