C20H40O4Si — CID 170702891
tert-butyl-[[(1S,2R,3R,4S)-3-(1-ethoxyethoxy)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-dimethylsilane (PubChem CID 170702891) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,3R,4S)-3-(1-ethoxyethoxy)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,3R,4S)-3-(1-ethoxyethoxy)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 170702891 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | tert-butyl-[[(1S,2R,3R,4S)-3-(1-ethoxyethoxy)-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-dimethylsilane |
| SMILES | CCOC(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)CC[C@@]1(C(C)C)O2 |
| InChI | InChI=1S/C20H40O4Si/c1-11-21-15(4)22-17-16(23-25(9,10)18(5,6)7)19(8)12-13-20(17,24-19)14(2)3/h14-17H,11-13H2,1-10H3/t15?,16-,17-,19+,20+/m1/s1 |
| InChIKey | SCMLLUSUZJNFHI-XQFXJUAJSA-N |
| XLogP | 5.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|