C24H46OSi2 — CID 11729209
tert-butyl-[2,2-dimethyl-3-[(1R,4S)-3-methyl-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propoxy]-dimethylsilane (PubChem CID 11729209) has the molecular formula C24H46OSi2 and a molecular weight of 406.80 g/mol. Its IUPAC name is tert-butyl-[2,2-dimethyl-3-[(1R,4S)-3-methyl-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2,2-dimethyl-3-[(1R,4S)-3-methyl-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11729209 |
| Molecular Formula | C24H46OSi2 |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | tert-butyl-[2,2-dimethyl-3-[(1R,4S)-3-methyl-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propoxy]-dimethylsilane |
| SMILES | CC1=C[C@@H](CC(C)(C)CO[Si](C)(C)C(C)(C)C)C[C@@H]1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C24H46OSi2/c1-20-16-21(17-22(20)14-12-13-15-26(7,8)9)18-24(5,6)19-25-27(10,11)23(2,3)4/h16,21-22H,12,14,17-19H2,1-11H3/t21-,22+/m1/s1 |
| InChIKey | ACFKGLDCDYBUBQ-YADHBBJMSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|