C27H45NO3SSi2 — CID 101022132
N-[(E)-3-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]prop-2-enyl]-4-methyl-N-(4-trimethylsilylbut-3-ynyl)benzenesulfonamide (PubChem CID 101022132) has the molecular formula C27H45NO3SSi2 and a molecular weight of 519.90 g/mol. Its IUPAC name is N-[(E)-3-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]prop-2-enyl]-4-methyl-N-(4-trimethylsilylbut-3-ynyl)benzenesulfonamide.
| Compound Name | N-[(E)-3-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]prop-2-enyl]-4-methyl-N-(4-trimethylsilylbut-3-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 101022132 |
| Molecular Formula | C27H45NO3SSi2 |
| Molecular Weight | 519.90 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-[(E)-3-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]prop-2-enyl]-4-methyl-N-(4-trimethylsilylbut-3-ynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C/C=C/[C@@H]2C[C@H]2CO[Si](C)(C)C(C)(C)C)CCC#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H45NO3SSi2/c1-23-14-16-26(17-15-23)32(29,30)28(18-10-11-20-33(5,6)7)19-12-13-24-21-25(24)22-31-34(8,9)27(2,3)4/h12-17,24-25H,10,18-19,21-22H2,1-9H3/b13-12+/t24-,25+/m1/s1 |
| InChIKey | REFLWXWPBDSERM-QMQMXIOFSA-N |
| XLogP | 6.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.90 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|