C24H52O3Si3 — CID 11091949
[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11091949) has the molecular formula C24H52O3Si3 and a molecular weight of 472.94 g/mol. Its IUPAC name is [(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11091949 |
| Molecular Formula | C24H52O3Si3 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | [(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O3Si3/c1-22(2,3)28(10,11)25-18-19-16-20(26-29(12,13)23(4,5)6)17-21(19)27-30(14,15)24(7,8)9/h16,20-21H,17-18H2,1-15H3/t20-,21-/m0/s1 |
| InChIKey | BORKPMVEWNYDKO-SFTDATJTSA-N |
| XLogP | 8.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|