C21H42O3Si2 — CID 134880747
2-[(3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethanol (PubChem CID 134880747) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is 2-[(3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethanol.
| Compound Name | 2-[(3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethanol |
|---|---|
| PubChem CID | 134880747 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-[(3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethanol |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=CCO)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si2/c1-16-18(23-25(8,9)20(2,3)4)14-17(12-13-22)15-19(16)24-26(10,11)21(5,6)7/h12,18-19,22H,1,13-15H2,2-11H3/t18-,19-/m0/s1 |
| InChIKey | YNQDHIQGHJNTPZ-OALUTQOASA-N |
| XLogP | 6.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|