C35H70O7Si3 — CID 10985310
diethyl (2E,4R,8R,9E)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,10-dimethylundeca-2,9-dienedioate (PubChem CID 10985310) has the molecular formula C35H70O7Si3 and a molecular weight of 687.20 g/mol. Its IUPAC name is diethyl (2E,4R,8R,9E)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,10-dimethylundeca-2,9-dienedioate.
| Compound Name | diethyl (2E,4R,8R,9E)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,10-dimethylundeca-2,9-dienedioate |
|---|---|
| PubChem CID | 10985310 |
| Molecular Formula | C35H70O7Si3 |
| Molecular Weight | 687.20 g/mol |
| Exact Mass | 686.44 |
| IUPAC Name | diethyl (2E,4R,8R,9E)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,10-dimethylundeca-2,9-dienedioate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](CC(C[C@H](/C=C(\C)C(=O)OCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H70O7Si3/c1-20-38-31(36)26(3)22-28(40-43(14,15)33(5,6)7)24-30(42-45(18,19)35(11,12)13)25-29(23-27(4)32(37)39-21-2)41-44(16,17)34(8,9)10/h22-23,28-30H,20-21,24-25H2,1-19H3/b26-22+,27-23+/t28-,29-/m0/s1 |
| InChIKey | PFPIQFWHBLXLDU-WFVQRVIESA-N |
| XLogP | 9.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.20 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|