C33H58O3Si — CID 10768565
[(6E,10E,14E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-yl] acetate (PubChem CID 10768565) has the molecular formula C33H58O3Si and a molecular weight of 530.91 g/mol. Its IUPAC name is [(6E,10E,14E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-yl] acetate.
| Compound Name | [(6E,10E,14E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-yl] acetate |
|---|---|
| PubChem CID | 10768565 |
| Molecular Formula | C33H58O3Si |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.42 |
| IUPAC Name | [(6E,10E,14E)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,11,15,19-tetramethylicosa-1,6,10,14,18-pentaen-3-yl] acetate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C(CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C33H58O3Si/c1-26(2)17-15-20-28(4)22-16-21-27(3)18-13-14-19-29(5)23-24-32(36-31(7)34)30(6)25-35-37(11,12)33(8,9)10/h17-19,22,32H,6,13-16,20-21,23-25H2,1-5,7-12H3/b27-18+,28-22+,29-19+ |
| InChIKey | YDUVFWZBSBZAFQ-IEMZVZHKSA-N |
| XLogP | 10.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|