C18H34O3Si — CID 22319904
ethyl 2-[5-[tert-butyl(dimethyl)silyl]oxycyclooctylidene]acetate (PubChem CID 22319904) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is ethyl 2-[5-[tert-butyl(dimethyl)silyl]oxycyclooctylidene]acetate.
| Compound Name | ethyl 2-[5-[tert-butyl(dimethyl)silyl]oxycyclooctylidene]acetate |
|---|---|
| PubChem CID | 22319904 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | ethyl 2-[5-[tert-butyl(dimethyl)silyl]oxycyclooctylidene]acetate |
| SMILES | CCOC(=O)C=C1CCCC(O[Si](C)(C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C18H34O3Si/c1-7-20-17(19)14-15-10-8-12-16(13-9-11-15)21-22(5,6)18(2,3)4/h14,16H,7-13H2,1-6H3/b15-14- |
| InChIKey | INVHJQYKZWHBCC-PFONDFGASA-N |
| XLogP | 5.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|