C23H46O6Si2 — CID 159587713
acetic acid;[(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate (PubChem CID 159587713) has the molecular formula C23H46O6Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is acetic acid;[(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate.
| Compound Name | acetic acid;[(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 159587713 |
| Molecular Formula | C23H46O6Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | acetic acid;[(4R,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)O.CC(=O)OCC1=CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O4Si2.C2H4O2/c1-16(22)23-15-17-12-13-18(24-26(8,9)20(2,3)4)14-19(17)25-27(10,11)21(5,6)7;1-2(3)4/h12,18-19H,13-15H2,1-11H3;1H3,(H,3,4)/t18-,19+;/m1./s1 |
| InChIKey | MJVKUXVIZJAENN-VOMIJIAVSA-N |
| XLogP | 6.14 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|