C9H22N4O4S — CID 23659761
N,N-diethylethanamine;(4,5-dihydro-1H-imidazol-2-ylamino) hydrogen sulfate (PubChem CID 23659761) has the molecular formula C9H22N4O4S and a molecular weight of 282.37 g/mol. Its IUPAC name is N,N-diethylethanamine;(4,5-dihydro-1H-imidazol-2-ylamino) hydrogen sulfate.
| Compound Name | N,N-diethylethanamine;(4,5-dihydro-1H-imidazol-2-ylamino) hydrogen sulfate |
|---|---|
| PubChem CID | 23659761 |
| Molecular Formula | C9H22N4O4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N,N-diethylethanamine;(4,5-dihydro-1H-imidazol-2-ylamino) hydrogen sulfate |
| SMILES | CCN(CC)CC.O=S(=O)(O)ONC1=NCCN1 |
| InChI | InChI=1S/C6H15N.C3H7N3O4S/c1-4-7(5-2)6-3;7-11(8,9)10-6-3-4-1-2-5-3/h4-6H2,1-3H3;1-2H2,(H2,4,5,6)(H,7,8,9) |
| InChIKey | PXXBOFAMWWOTBF-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|