About (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine
(2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine (PubChem CID 23659845) has the molecular formula C13H18BrNO
and a molecular weight of 284.20 g/mol. Its IUPAC name is (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine |
| PubChem CID | 23659845 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine |
| SMILES | CC(C)(C)[C@H]1CO[C@@H](c2cccc(Br)c2)N1 |
| InChI | InChI=1S/C13H18BrNO/c1-13(2,3)11-8-16-12(15-11)9-5-4-6-10(14)7-9/h4-7,11-12,15H,8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | AMROTLHKLSAOTR-NEPJUHHUSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine?
The IUPAC name of (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine (CID 23659845) is (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine.
What is the SMILES notation for (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine?
The canonical SMILES for (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine is CC(C)(C)[C@H]1CO[C@@H](c2cccc(Br)c2)N1.
What is the InChIKey of (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine?
The InChIKey is AMROTLHKLSAOTR-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H18BrNO/c1-13(2,3)11-8-16-12(15-11)9-5-4-6-10(14)7-9/h4-7,11-12,15H,8H2,1-3H3/t11-,12+/m1/s1.
What are the key properties of (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine?
(2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine has a molecular weight of 284.20 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2-(3-bromophenyl)-4-tert-butyl-1,3-oxazolidine is sourced from PubChem (CID 23659845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).