C11H17N2NaO2S — CID 23665410
sodium 5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidine-2-thiolate (PubChem CID 23665410) has the molecular formula C11H17N2NaO2S and a molecular weight of 264.33 g/mol. Its IUPAC name is sodium 5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidine-2-thiolate.
| Compound Name | sodium 5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidine-2-thiolate |
|---|---|
| PubChem CID | 23665410 |
| Molecular Formula | C11H17N2NaO2S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | sodium 5-ethyl-4,6-dioxo-5-pentan-2-yl-1H-pyrimidine-2-thiolate |
| SMILES | CCCC(C)C1(CC)C(=O)N=C([S-])NC1=O.[Na+] |
| InChI | InChI=1S/C11H18N2O2S.Na/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15;/h7H,4-6H2,1-3H3,(H2,12,13,14,15,16);/q;+1/p-1 |
| InChIKey | AWLILQARPMWUHA-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|