C12H17N2NaO2S — CID 23716026
sodium 5-butan-2-yl-5-(2-methylprop-2-enyl)-4,6-dioxo-1H-pyrimidine-2-thiolate (PubChem CID 23716026) has the molecular formula C12H17N2NaO2S and a molecular weight of 276.34 g/mol. Its IUPAC name is sodium 5-butan-2-yl-5-(2-methylprop-2-enyl)-4,6-dioxo-1H-pyrimidine-2-thiolate.
| Compound Name | sodium 5-butan-2-yl-5-(2-methylprop-2-enyl)-4,6-dioxo-1H-pyrimidine-2-thiolate |
|---|---|
| PubChem CID | 23716026 |
| Molecular Formula | C12H17N2NaO2S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | sodium 5-butan-2-yl-5-(2-methylprop-2-enyl)-4,6-dioxo-1H-pyrimidine-2-thiolate |
| SMILES | C=C(C)CC1(C(C)CC)C(=O)N=C([S-])NC1=O.[Na+] |
| InChI | InChI=1S/C12H18N2O2S.Na/c1-5-8(4)12(6-7(2)3)9(15)13-11(17)14-10(12)16;/h8H,2,5-6H2,1,3-4H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | YALYDAULSCELCN-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|