C8H13LiO — CID 23666726
lithium (3R,5S)-3,5-dimethylcyclohexen-1-olate (PubChem CID 23666726) has the molecular formula C8H13LiO and a molecular weight of 132.13 g/mol. Its IUPAC name is lithium (3R,5S)-3,5-dimethylcyclohexen-1-olate.
| Compound Name | lithium (3R,5S)-3,5-dimethylcyclohexen-1-olate |
|---|---|
| PubChem CID | 23666726 |
| Molecular Formula | C8H13LiO |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | lithium (3R,5S)-3,5-dimethylcyclohexen-1-olate |
| SMILES | C[C@@H]1CC([O-])=C[C@H](C)C1.[Li+] |
| InChI | InChI=1S/C8H14O.Li/c1-6-3-7(2)5-8(9)4-6;/h4,6-7,9H,3,5H2,1-2H3;/q;+1/p-1/t6-,7+;/m1./s1 |
| InChIKey | NYHMCFRNXGUUAT-HHQFNNIRSA-M |
| XLogP | -1.70 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |