potassium 6-methylcyclohexen-1-olate

C7H11KO — CID 23685818

IUPACpotassium 6-methylcyclohexen-1-olate
SMILESCC1CCCC=C1[O-].[K+]
InChIInChI=1S/C7H12O.K/c1-6-4-2-3-5-7(6)8;/h5-6,8H,2-4H2,1H3;/q;+1/p-1
InChIKeySEHIOLMENBIFJD-UHFFFAOYSA-M
MW150.26 g/mol
LogP-1.95
Rot. Bonds

About potassium 6-methylcyclohexen-1-olate

potassium 6-methylcyclohexen-1-olate (PubChem CID 23685818) has the molecular formula C7H11KO and a molecular weight of 150.26 g/mol. Its IUPAC name is potassium 6-methylcyclohexen-1-olate.

Molecular Properties

Compound Namepotassium 6-methylcyclohexen-1-olate
PubChem CID23685818
Molecular FormulaC7H11KO
Molecular Weight150.26 g/mol
Exact Mass150.04
IUPAC Namepotassium 6-methylcyclohexen-1-olate
SMILESCC1CCCC=C1[O-].[K+]
InChIInChI=1S/C7H12O.K/c1-6-4-2-3-5-7(6)8;/h5-6,8H,2-4H2,1H3;/q;+1/p-1
InChIKeySEHIOLMENBIFJD-UHFFFAOYSA-M
XLogP-1.95
TPSA23.06 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.26
LogP ≤ 5-1.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze potassium 6-methylcyclohexen-1-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 6-methylcyclohexen-1-olate?
The IUPAC name of potassium 6-methylcyclohexen-1-olate (CID 23685818) is potassium 6-methylcyclohexen-1-olate.
What is the SMILES notation for potassium 6-methylcyclohexen-1-olate?
The canonical SMILES for potassium 6-methylcyclohexen-1-olate is CC1CCCC=C1[O-].[K+].
What is the InChIKey of potassium 6-methylcyclohexen-1-olate?
The InChIKey is SEHIOLMENBIFJD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O.K/c1-6-4-2-3-5-7(6)8;/h5-6,8H,2-4H2,1H3;/q;+1/p-1.
What are the key properties of potassium 6-methylcyclohexen-1-olate?
potassium 6-methylcyclohexen-1-olate has a molecular weight of 150.26 g/mol, XLogP of -1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 6-methylcyclohexen-1-olate is sourced from PubChem (CID 23685818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).