C16H14ClKN2O5S — CID 23666853
potassium [(E)-1-[4-chloro-2-[(2-methylbenzoyl)amino]phenyl]ethylideneamino] sulfate (PubChem CID 23666853) has the molecular formula C16H14ClKN2O5S and a molecular weight of 420.92 g/mol. Its IUPAC name is potassium [(E)-1-[4-chloro-2-[(2-methylbenzoyl)amino]phenyl]ethylideneamino] sulfate.
| Compound Name | potassium [(E)-1-[4-chloro-2-[(2-methylbenzoyl)amino]phenyl]ethylideneamino] sulfate |
|---|---|
| PubChem CID | 23666853 |
| Molecular Formula | C16H14ClKN2O5S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | potassium [(E)-1-[4-chloro-2-[(2-methylbenzoyl)amino]phenyl]ethylideneamino] sulfate |
| SMILES | C/C(=N\OS(=O)(=O)[O-])c1ccc(Cl)cc1NC(=O)c1ccccc1C.[K+] |
| InChI | InChI=1S/C16H15ClN2O5S.K/c1-10-5-3-4-6-13(10)16(20)18-15-9-12(17)7-8-14(15)11(2)19-24-25(21,22)23;/h3-9H,1-2H3,(H,18,20)(H,21,22,23);/q;+1/p-1/b19-11+; |
| InChIKey | XFICZMNIIYRXLW-YLFUTEQJSA-M |
| XLogP | 0.11 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|