About sodium 16-methylheptadecanoate
sodium 16-methylheptadecanoate (PubChem CID 23668820) has the molecular formula C18H35NaO2
and a molecular weight of 306.47 g/mol. Its IUPAC name is sodium 16-methylheptadecanoate.
Molecular Properties
| Compound Name | sodium 16-methylheptadecanoate |
| PubChem CID | 23668820 |
| Molecular Formula | C18H35NaO2 |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | sodium 16-methylheptadecanoate |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H36O2.Na/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;/h17H,3-16H2,1-2H3,(H,19,20);/q;+1/p-1 |
| InChIKey | FRHNXUKHAUWMOQ-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 16-methylheptadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 16-methylheptadecanoate?
The IUPAC name of sodium 16-methylheptadecanoate (CID 23668820) is sodium 16-methylheptadecanoate.
What is the SMILES notation for sodium 16-methylheptadecanoate?
The canonical SMILES for sodium 16-methylheptadecanoate is CC(C)CCCCCCCCCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium 16-methylheptadecanoate?
The InChIKey is FRHNXUKHAUWMOQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H36O2.Na/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;/h17H,3-16H2,1-2H3,(H,19,20);/q;+1/p-1.
What are the key properties of sodium 16-methylheptadecanoate?
sodium 16-methylheptadecanoate has a molecular weight of 306.47 g/mol, XLogP of 1.86, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 16-methylheptadecanoate is sourced from PubChem (CID 23668820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).