2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid

C13H12Cl2O4 — CID 3278

💊View drug profile → ethacrynic acid
IUPAC2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid
SMILESC=C(CC)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl
InChIInChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17)
InChIKeyAVOLMBLBETYQHX-UHFFFAOYSA-N
MW303.14 g/mol
LogP3.61
Rot. Bonds6

About 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid

2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid (PubChem CID 3278) has the molecular formula C13H12Cl2O4 and a molecular weight of 303.14 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid
PubChem CID3278
Molecular FormulaC13H12Cl2O4
Molecular Weight303.14 g/mol
Exact Mass302.01
IUPAC Name2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid
SMILESC=C(CC)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl
InChIInChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17)
InChIKeyAVOLMBLBETYQHX-UHFFFAOYSA-N
XLogP3.61
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.14
LogP ≤ 53.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid?
The IUPAC name of 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid (CID 3278) is 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid?
The canonical SMILES for 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid is C=C(CC)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl.
What is the InChIKey of 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid?
The InChIKey is AVOLMBLBETYQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17).
What are the key properties of 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid?
2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid has a molecular weight of 303.14 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid is sourced from PubChem (CID 3278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).