C14H18ClNaO3 — CID 23668914
sodium 2-chloro-3-[4-(2,2-dimethylpropoxy)phenyl]propanoate (PubChem CID 23668914) has the molecular formula C14H18ClNaO3 and a molecular weight of 292.74 g/mol. Its IUPAC name is sodium 2-chloro-3-[4-(2,2-dimethylpropoxy)phenyl]propanoate.
| Compound Name | sodium 2-chloro-3-[4-(2,2-dimethylpropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 23668914 |
| Molecular Formula | C14H18ClNaO3 |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | sodium 2-chloro-3-[4-(2,2-dimethylpropoxy)phenyl]propanoate |
| SMILES | CC(C)(C)COc1ccc(CC(Cl)C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C14H19ClO3.Na/c1-14(2,3)9-18-11-6-4-10(5-7-11)8-12(15)13(16)17;/h4-7,12H,8-9H2,1-3H3,(H,16,17);/q;+1/p-1 |
| InChIKey | DDJUGKALDNAPLK-UHFFFAOYSA-M |
| XLogP | -0.98 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|