C17H20N4O3 — CID 2366895
5,5-diethyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 2366895) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5,5-diethyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2366895 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5,5-diethyl-3-[(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(Cc2cc(=O)n3cc(C)ccc3n2)C1=O |
| InChI | InChI=1S/C17H20N4O3/c1-4-17(5-2)15(23)21(16(24)19-17)10-12-8-14(22)20-9-11(3)6-7-13(20)18-12/h6-9H,4-5,10H2,1-3H3,(H,19,24) |
| InChIKey | TYRUAHGPROBKGA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|