C17H25N2NaO7 — CID 23671556
sodium (2S)-1-[(2S,3S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylate (PubChem CID 23671556) has the molecular formula C17H25N2NaO7 and a molecular weight of 392.38 g/mol. Its IUPAC name is sodium (2S)-1-[(2S,3S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | sodium (2S)-1-[(2S,3S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 23671556 |
| Molecular Formula | C17H25N2NaO7 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | sodium (2S)-1-[(2S,3S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)[O-])[C@@H](C)CC.[Na+] |
| InChI | InChI=1S/C17H26N2O7.Na/c1-4-9(3)11(15(21)19-8-6-7-10(19)16(22)23)18-14(20)12-13(26-12)17(24)25-5-2;/h9-13H,4-8H2,1-3H3,(H,18,20)(H,22,23);/q;+1/p-1/t9-,10-,11-,12-,13-;/m0./s1 |
| InChIKey | SLPRWMXYBKQCKQ-SWCKNIAISA-M |
| XLogP | -4.41 |
| TPSA | 128.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|