C19H31N3O6 — CID 134694139
methyl 1-[(2S,3S)-3-methyl-2-[[(2S)-3-(propylcarbamoyl)oxirane-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carboxylate (PubChem CID 134694139) has the molecular formula C19H31N3O6 and a molecular weight of 397.47 g/mol. Its IUPAC name is methyl 1-[(2S,3S)-3-methyl-2-[[(2S)-3-(propylcarbamoyl)oxirane-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(2S,3S)-3-methyl-2-[[(2S)-3-(propylcarbamoyl)oxirane-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134694139 |
| Molecular Formula | C19H31N3O6 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | methyl 1-[(2S,3S)-3-methyl-2-[[(2S)-3-(propylcarbamoyl)oxirane-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCNC(=O)C1O[C@@H]1C(=O)N[C@H](C(=O)N1CCCC1C(=O)OC)[C@@H](C)CC |
| InChI | InChI=1S/C19H31N3O6/c1-5-9-20-16(23)14-15(28-14)17(24)21-13(11(3)6-2)18(25)22-10-7-8-12(22)19(26)27-4/h11-15H,5-10H2,1-4H3,(H,20,23)(H,21,24)/t11-,12?,13-,14?,15-/m0/s1 |
| InChIKey | XGWSRLSPWIEMLQ-UHKNOIMOSA-N |
| XLogP | -0.03 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|