C13H20N2O5 — CID 174660791
methyl (2S)-1-[2-(propylcarbamoyl)oxirane-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 174660791) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is methyl (2S)-1-[2-(propylcarbamoyl)oxirane-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-(propylcarbamoyl)oxirane-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 174660791 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | methyl (2S)-1-[2-(propylcarbamoyl)oxirane-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCCNC(=O)C1(C(=O)N2CCC[C@H]2C(=O)OC)CO1 |
| InChI | InChI=1S/C13H20N2O5/c1-3-6-14-11(17)13(8-20-13)12(18)15-7-4-5-9(15)10(16)19-2/h9H,3-8H2,1-2H3,(H,14,17)/t9-,13?/m0/s1 |
| InChIKey | GBJWZTOSTYJMFK-LLTODGECSA-N |
| XLogP | -0.55 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|