C12H19N2NaO2S2 — CID 23674496
sodium 5-(2-methylsulfanylethyl)-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (PubChem CID 23674496) has the molecular formula C12H19N2NaO2S2 and a molecular weight of 310.42 g/mol. Its IUPAC name is sodium 5-(2-methylsulfanylethyl)-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
| Compound Name | sodium 5-(2-methylsulfanylethyl)-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
|---|---|
| PubChem CID | 23674496 |
| Molecular Formula | C12H19N2NaO2S2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | sodium 5-(2-methylsulfanylethyl)-5-pentan-2-yl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| SMILES | CCCC(C)C1(CCSC)C(=O)[N-]C(=S)NC1=O.[Na+] |
| InChI | InChI=1S/C12H20N2O2S2.Na/c1-4-5-8(2)12(6-7-18-3)9(15)13-11(17)14-10(12)16;/h8H,4-7H2,1-3H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | IPFUISOJBWATGQ-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|