About sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate
sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate (PubChem CID 23674805) has the molecular formula C10H17NaO4
and a molecular weight of 224.23 g/mol. Its IUPAC name is sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate.
Molecular Properties
| Compound Name | sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate |
| PubChem CID | 23674805 |
| Molecular Formula | C10H17NaO4 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate |
| SMILES | CCOC(=O)[C-](C)C(=O)OC(C)(C)C.[Na+] |
| InChI | InChI=1S/C10H17O4.Na/c1-6-13-8(11)7(2)9(12)14-10(3,4)5;/h6H2,1-5H3;/q-1;+1 |
| InChIKey | CBOZGQJYAXTBGD-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate?
The IUPAC name of sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate (CID 23674805) is sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate.
What is the SMILES notation for sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate?
The canonical SMILES for sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate is CCOC(=O)[C-](C)C(=O)OC(C)(C)C.[Na+].
What is the InChIKey of sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate?
The InChIKey is CBOZGQJYAXTBGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O4.Na/c1-6-13-8(11)7(2)9(12)14-10(3,4)5;/h6H2,1-5H3;/q-1;+1.
What are the key properties of sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate?
sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate has a molecular weight of 224.23 g/mol, XLogP of -1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-O-tert-butyl 1-O-ethyl 2-methylpropanedioate is sourced from PubChem (CID 23674805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).