About sodium ethyl 2-methylpropanoate
sodium ethyl 2-methylpropanoate (PubChem CID 21400557) has the molecular formula C6H11NaO2
and a molecular weight of 138.14 g/mol. Its IUPAC name is sodium ethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | sodium ethyl 2-methylpropanoate |
| PubChem CID | 21400557 |
| Molecular Formula | C6H11NaO2 |
| Molecular Weight | 138.14 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | sodium ethyl 2-methylpropanoate |
| SMILES | CCOC(=O)[C-](C)C.[Na+] |
| InChI | InChI=1S/C6H11O2.Na/c1-4-8-6(7)5(2)3;/h4H2,1-3H3;/q-1;+1 |
| InChIKey | LIQKSMSKZFPWQJ-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.14 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium ethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium ethyl 2-methylpropanoate?
The IUPAC name of sodium ethyl 2-methylpropanoate (CID 21400557) is sodium ethyl 2-methylpropanoate.
What is the SMILES notation for sodium ethyl 2-methylpropanoate?
The canonical SMILES for sodium ethyl 2-methylpropanoate is CCOC(=O)[C-](C)C.[Na+].
What is the InChIKey of sodium ethyl 2-methylpropanoate?
The InChIKey is LIQKSMSKZFPWQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O2.Na/c1-4-8-6(7)5(2)3;/h4H2,1-3H3;/q-1;+1.
What are the key properties of sodium ethyl 2-methylpropanoate?
sodium ethyl 2-methylpropanoate has a molecular weight of 138.14 g/mol, XLogP of -1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium ethyl 2-methylpropanoate is sourced from PubChem (CID 21400557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).