C19H26LiN3O5 — CID 23675499
lithium (2S)-3-cyclohexyl-2-[[4-(furan-2-carbonyl)piperazine-1-carbonyl]amino]propanoate (PubChem CID 23675499) has the molecular formula C19H26LiN3O5 and a molecular weight of 383.37 g/mol. Its IUPAC name is lithium (2S)-3-cyclohexyl-2-[[4-(furan-2-carbonyl)piperazine-1-carbonyl]amino]propanoate.
| Compound Name | lithium (2S)-3-cyclohexyl-2-[[4-(furan-2-carbonyl)piperazine-1-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 23675499 |
| Molecular Formula | C19H26LiN3O5 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | lithium (2S)-3-cyclohexyl-2-[[4-(furan-2-carbonyl)piperazine-1-carbonyl]amino]propanoate |
| SMILES | O=C([O-])[C@H](CC1CCCCC1)NC(=O)N1CCN(C(=O)c2ccco2)CC1.[Li+] |
| InChI | InChI=1S/C19H27N3O5.Li/c23-17(16-7-4-12-27-16)21-8-10-22(11-9-21)19(26)20-15(18(24)25)13-14-5-2-1-3-6-14;/h4,7,12,14-15H,1-3,5-6,8-11,13H2,(H,20,26)(H,24,25);/q;+1/p-1/t15-;/m0./s1 |
| InChIKey | RTZJJOBTIZMRJK-RSAXXLAASA-M |
| XLogP | -2.16 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |