C20H21KO11S — CID 23679294
potassium [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-2-(hydroxymethyl)oxan-3-yl] sulfate (PubChem CID 23679294) has the molecular formula C20H21KO11S and a molecular weight of 508.54 g/mol. Its IUPAC name is potassium [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-2-(hydroxymethyl)oxan-3-yl] sulfate.
| Compound Name | potassium [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-2-(hydroxymethyl)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 23679294 |
| Molecular Formula | C20H21KO11S |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | potassium [(2R,3S,4R,5R,6S)-4,5-dihydroxy-6-[3-hydroxy-5-[(Z)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-2-(hydroxymethyl)oxan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@H]1[C@H](O)[C@@H](O)[C@H](Oc2cc(O)cc(/C=C\c3ccc(O)cc3)c2)O[C@@H]1CO.[K+] |
| InChI | InChI=1S/C20H22O11S.K/c21-10-16-19(31-32(26,27)28)17(24)18(25)20(30-16)29-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11;/h1-9,16-25H,10H2,(H,26,27,28);/q;+1/p-1/b2-1-;/t16-,17-,18-,19-,20-;/m1./s1 |
| InChIKey | QIORKINAMLSNHA-LLQQIDOTSA-M |
| XLogP | -3.06 |
| TPSA | 186.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|