C10H11KN2O6S2 — CID 23680939
potassium 3-methoxy-2-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidine-1-sulfonate (PubChem CID 23680939) has the molecular formula C10H11KN2O6S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is potassium 3-methoxy-2-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidine-1-sulfonate.
| Compound Name | potassium 3-methoxy-2-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidine-1-sulfonate |
|---|---|
| PubChem CID | 23680939 |
| Molecular Formula | C10H11KN2O6S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | potassium 3-methoxy-2-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidine-1-sulfonate |
| SMILES | COC1(NC(=O)Cc2cccs2)CN(S(=O)(=O)[O-])C1=O.[K+] |
| InChI | InChI=1S/C10H12N2O6S2.K/c1-18-10(6-12(9(10)14)20(15,16)17)11-8(13)5-7-3-2-4-19-7;/h2-4H,5-6H2,1H3,(H,11,13)(H,15,16,17);/q;+1/p-1 |
| InChIKey | FDRWOQLUINKHSA-UHFFFAOYSA-M |
| XLogP | -3.94 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|