C22H23N2NaO4S — CID 23681246
sodium 6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3,5-dihydroxy-3-methylhexanoate (PubChem CID 23681246) has the molecular formula C22H23N2NaO4S and a molecular weight of 434.49 g/mol. Its IUPAC name is sodium 6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3,5-dihydroxy-3-methylhexanoate.
| Compound Name | sodium 6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3,5-dihydroxy-3-methylhexanoate |
|---|---|
| PubChem CID | 23681246 |
| Molecular Formula | C22H23N2NaO4S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | sodium 6-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-3,5-dihydroxy-3-methylhexanoate |
| SMILES | CC(O)(CC(=O)[O-])CC(O)CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.[Na+] |
| InChI | InChI=1S/C22H24N2O4S.Na/c1-22(28,13-18(26)27)12-17(25)14-29-21-23-19(15-8-4-2-5-9-15)20(24-21)16-10-6-3-7-11-16;/h2-11,17,25,28H,12-14H2,1H3,(H,23,24)(H,26,27);/q;+1/p-1 |
| InChIKey | BWNYTAUEBWFGHV-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |