C7H11N2NaO3 — CID 23686064
sodium 2-(2,2-dimethyl-5-oxoimidazolidin-1-yl)acetate (PubChem CID 23686064) has the molecular formula C7H11N2NaO3 and a molecular weight of 194.17 g/mol. Its IUPAC name is sodium 2-(2,2-dimethyl-5-oxoimidazolidin-1-yl)acetate.
| Compound Name | sodium 2-(2,2-dimethyl-5-oxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 23686064 |
| Molecular Formula | C7H11N2NaO3 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | sodium 2-(2,2-dimethyl-5-oxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NCC(=O)N1CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H12N2O3.Na/c1-7(2)8-3-5(10)9(7)4-6(11)12;/h8H,3-4H2,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | CJIXHQXDZCXSIR-UHFFFAOYSA-M |
| XLogP | -5.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |