C17H16ClN2NaO5S2 — CID 23686663
sodium 2-[4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate (PubChem CID 23686663) has the molecular formula C17H16ClN2NaO5S2 and a molecular weight of 450.90 g/mol. Its IUPAC name is sodium 2-[4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate.
| Compound Name | sodium 2-[4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate |
|---|---|
| PubChem CID | 23686663 |
| Molecular Formula | C17H16ClN2NaO5S2 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | sodium 2-[4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate |
| SMILES | O=S(=O)([O-])CCS(=O)(=O)c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1.[Na+] |
| InChI | InChI=1S/C17H17ClN2O5S2.Na/c18-14-3-1-13(2-4-14)17-9-10-20(19-17)15-5-7-16(8-6-15)26(21,22)11-12-27(23,24)25;/h1-8H,9-12H2,(H,23,24,25);/q;+1/p-1 |
| InChIKey | CUKVLWAEAKAWHX-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|