C18H17Cl2N2NaO5S2 — CID 23686676
sodium 2-[4-[5-(4,5-dichloro-2-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate (PubChem CID 23686676) has the molecular formula C18H17Cl2N2NaO5S2 and a molecular weight of 499.37 g/mol. Its IUPAC name is sodium 2-[4-[5-(4,5-dichloro-2-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate.
| Compound Name | sodium 2-[4-[5-(4,5-dichloro-2-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate |
|---|---|
| PubChem CID | 23686676 |
| Molecular Formula | C18H17Cl2N2NaO5S2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | sodium 2-[4-[5-(4,5-dichloro-2-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethanesulfonate |
| SMILES | Cc1cc(Cl)c(Cl)cc1C1=NN(c2ccc(S(=O)(=O)CCS(=O)(=O)[O-])cc2)CC1.[Na+] |
| InChI | InChI=1S/C18H18Cl2N2O5S2.Na/c1-12-10-16(19)17(20)11-15(12)18-6-7-22(21-18)13-2-4-14(5-3-13)28(23,24)8-9-29(25,26)27;/h2-5,10-11H,6-9H2,1H3,(H,25,26,27);/q;+1/p-1 |
| InChIKey | ZRHVIBPVGBXNFG-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|