About potassium;oxido(dioxo)niobium;stiboric acid
potassium;oxido(dioxo)niobium;stiboric acid (PubChem CID 23688136) has the molecular formula H3KNbO7Sb
and a molecular weight of 368.78 g/mol. Its IUPAC name is potassium;oxido(dioxo)niobium;stiboric acid.
Molecular Properties
| Compound Name | potassium;oxido(dioxo)niobium;stiboric acid |
| PubChem CID | 23688136 |
| Molecular Formula | H3KNbO7Sb |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 367.76 |
| IUPAC Name | potassium;oxido(dioxo)niobium;stiboric acid |
| SMILES | O=[Nb](=O)[O-].O=[Sb](O)(O)O.[K+] |
| InChI | InChI=1S/K.Nb.3H2O.4O.Sb/h;;3*1H2;;;;;/q+1;;;;;;;;-1;+3/p-3 |
| InChIKey | GMUWKQKVVVJGHW-UHFFFAOYSA-K |
| XLogP | -6.60 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;oxido(dioxo)niobium;stiboric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;oxido(dioxo)niobium;stiboric acid?
The IUPAC name of potassium;oxido(dioxo)niobium;stiboric acid (CID 23688136) is potassium;oxido(dioxo)niobium;stiboric acid.
What is the SMILES notation for potassium;oxido(dioxo)niobium;stiboric acid?
The canonical SMILES for potassium;oxido(dioxo)niobium;stiboric acid is O=[Nb](=O)[O-].O=[Sb](O)(O)O.[K+].
What is the InChIKey of potassium;oxido(dioxo)niobium;stiboric acid?
The InChIKey is GMUWKQKVVVJGHW-UHFFFAOYSA-K. The full InChI is InChI=1S/K.Nb.3H2O.4O.Sb/h;;3*1H2;;;;;/q+1;;;;;;;;-1;+3/p-3.
What are the key properties of potassium;oxido(dioxo)niobium;stiboric acid?
potassium;oxido(dioxo)niobium;stiboric acid has a molecular weight of 368.78 g/mol, XLogP of -6.60, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;oxido(dioxo)niobium;stiboric acid is sourced from PubChem (CID 23688136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).