C8H13NaO4 — CID 23691603
sodium 1,3-diethoxy-2-methyl-3-oxoprop-1-en-1-olate (PubChem CID 23691603) has the molecular formula C8H13NaO4 and a molecular weight of 196.18 g/mol. Its IUPAC name is sodium 1,3-diethoxy-2-methyl-3-oxoprop-1-en-1-olate.
| Compound Name | sodium 1,3-diethoxy-2-methyl-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 23691603 |
| Molecular Formula | C8H13NaO4 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | sodium 1,3-diethoxy-2-methyl-3-oxoprop-1-en-1-olate |
| SMILES | CCOC(=O)C(C)=C([O-])OCC.[Na+] |
| InChI | InChI=1S/C8H14O4.Na/c1-4-11-7(9)6(3)8(10)12-5-2;/h9H,4-5H2,1-3H3;/q;+1/p-1 |
| InChIKey | CXQMBVBXVCTLLJ-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|