C22H30FKO5 — CID 23692778
potassium 3-[(10S,11S,13S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]propanoate (PubChem CID 23692778) has the molecular formula C22H30FKO5 and a molecular weight of 432.57 g/mol. Its IUPAC name is potassium 3-[(10S,11S,13S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]propanoate.
| Compound Name | potassium 3-[(10S,11S,13S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]propanoate |
|---|---|
| PubChem CID | 23692778 |
| Molecular Formula | C22H30FKO5 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | potassium 3-[(10S,11S,13S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]propanoate |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C3CC[C@@](O)(CCC(=O)[O-])[C@@]3(C)C[C@H](O)C12F.[K+] |
| InChI | InChI=1S/C22H31FO5.K/c1-19-8-5-14(24)11-13(19)3-4-16-15-6-9-21(28,10-7-18(26)27)20(15,2)12-17(25)22(16,19)23;/h11,15-17,25,28H,3-10,12H2,1-2H3,(H,26,27);/q;+1/p-1/t15?,16?,17-,19-,20-,21+,22?;/m0./s1 |
| InChIKey | QCXHKKYTSUZRDF-KJVJEOKVSA-M |
| XLogP | -1.15 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |