C15H26GeNaO3P — CID 23693660
sodium [hydroxy(phenyl)methyl]-(2-triethylgermylethyl)phosphinate (PubChem CID 23693660) has the molecular formula C15H26GeNaO3P and a molecular weight of 380.94 g/mol. Its IUPAC name is sodium [hydroxy(phenyl)methyl]-(2-triethylgermylethyl)phosphinate.
| Compound Name | sodium [hydroxy(phenyl)methyl]-(2-triethylgermylethyl)phosphinate |
|---|---|
| PubChem CID | 23693660 |
| Molecular Formula | C15H26GeNaO3P |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | sodium [hydroxy(phenyl)methyl]-(2-triethylgermylethyl)phosphinate |
| SMILES | CC[Ge](CC)(CC)CCP(=O)([O-])C(O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C15H27GeO3P.Na/c1-4-16(5-2,6-3)12-13-20(18,19)15(17)14-10-8-7-9-11-14;/h7-11,15,17H,4-6,12-13H2,1-3H3,(H,18,19);/q;+1/p-1 |
| InChIKey | MTHDOLXVQXKYGO-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|