About sodium 2-naphthalen-1-ylacetate
sodium 2-naphthalen-1-ylacetate (PubChem CID 23694671) has the molecular formula C12H9NaO2
and a molecular weight of 208.19 g/mol. Its IUPAC name is sodium 2-naphthalen-1-ylacetate.
Molecular Properties
| Compound Name | sodium 2-naphthalen-1-ylacetate |
| PubChem CID | 23694671 |
| Molecular Formula | C12H9NaO2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | sodium 2-naphthalen-1-ylacetate |
| SMILES | O=C([O-])Cc1cccc2ccccc12.[Na+] |
| InChI | InChI=1S/C12H10O2.Na/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);/q;+1/p-1 |
| InChIKey | CJUUXVFWKYRHAR-UHFFFAOYSA-M |
| XLogP | -1.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 2-naphthalen-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-naphthalen-1-ylacetate?
The IUPAC name of sodium 2-naphthalen-1-ylacetate (CID 23694671) is sodium 2-naphthalen-1-ylacetate.
What is the SMILES notation for sodium 2-naphthalen-1-ylacetate?
The canonical SMILES for sodium 2-naphthalen-1-ylacetate is O=C([O-])Cc1cccc2ccccc12.[Na+].
What is the InChIKey of sodium 2-naphthalen-1-ylacetate?
The InChIKey is CJUUXVFWKYRHAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O2.Na/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);/q;+1/p-1.
What are the key properties of sodium 2-naphthalen-1-ylacetate?
sodium 2-naphthalen-1-ylacetate has a molecular weight of 208.19 g/mol, XLogP of -1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-naphthalen-1-ylacetate is sourced from PubChem (CID 23694671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).