C6H14KO2PS2 — CID 23699412
potassium butan-2-ylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane (PubChem CID 23699412) has the molecular formula C6H14KO2PS2 and a molecular weight of 252.38 g/mol. Its IUPAC name is potassium butan-2-ylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane.
| Compound Name | potassium butan-2-ylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23699412 |
| Molecular Formula | C6H14KO2PS2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | potassium butan-2-ylsulfanyl-ethoxy-oxido-sulfanylidene-λ5-phosphane |
| SMILES | CCOP([O-])(=S)SC(C)CC.[K+] |
| InChI | InChI=1S/C6H15O2PS2.K/c1-4-6(3)11-9(7,10)8-5-2;/h6H,4-5H2,1-3H3,(H,7,10);/q;+1/p-1 |
| InChIKey | KSRBNLFWRTYLTG-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|