C19H15NaO5 — CID 23701280
sodium 3-[1-(4-hydroxyphenyl)-3-oxobutyl]-4-oxochromen-2-olate (PubChem CID 23701280) has the molecular formula C19H15NaO5 and a molecular weight of 346.31 g/mol. Its IUPAC name is sodium 3-[1-(4-hydroxyphenyl)-3-oxobutyl]-4-oxochromen-2-olate.
| Compound Name | sodium 3-[1-(4-hydroxyphenyl)-3-oxobutyl]-4-oxochromen-2-olate |
|---|---|
| PubChem CID | 23701280 |
| Molecular Formula | C19H15NaO5 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | sodium 3-[1-(4-hydroxyphenyl)-3-oxobutyl]-4-oxochromen-2-olate |
| SMILES | CC(=O)CC(c1ccc(O)cc1)c1c([O-])oc2ccccc2c1=O.[Na+] |
| InChI | InChI=1S/C19H16O5.Na/c1-11(20)10-15(12-6-8-13(21)9-7-12)17-18(22)14-4-2-3-5-16(14)24-19(17)23;/h2-9,15,21,23H,10H2,1H3;/q;+1/p-1 |
| InChIKey | GSKSZTNQCVRMCA-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |