About sodium;oxido(trioxo)rhenium;sulfurothioic O-acid
sodium;oxido(trioxo)rhenium;sulfurothioic O-acid (PubChem CID 23708886) has the molecular formula H2NaO7ReS2
and a molecular weight of 387.34 g/mol. Its IUPAC name is sodium;oxido(trioxo)rhenium;sulfurothioic O-acid.
Molecular Properties
| Compound Name | sodium;oxido(trioxo)rhenium;sulfurothioic O-acid |
| PubChem CID | 23708886 |
| Molecular Formula | H2NaO7ReS2 |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.87 |
| IUPAC Name | sodium;oxido(trioxo)rhenium;sulfurothioic O-acid |
| SMILES | O=S(O)(O)=S.O=[Re](=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/Na.H2O3S2.4O.Re/c;1-5(2,3)4;;;;;/h;(H2,1,2,3,4);;;;;/q+1;;;;;-1; |
| InChIKey | JVMKHFTTXWORHH-UHFFFAOYSA-N |
| XLogP | -4.87 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium;oxido(trioxo)rhenium;sulfurothioic O-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;oxido(trioxo)rhenium;sulfurothioic O-acid?
The IUPAC name of sodium;oxido(trioxo)rhenium;sulfurothioic O-acid (CID 23708886) is sodium;oxido(trioxo)rhenium;sulfurothioic O-acid.
What is the SMILES notation for sodium;oxido(trioxo)rhenium;sulfurothioic O-acid?
The canonical SMILES for sodium;oxido(trioxo)rhenium;sulfurothioic O-acid is O=S(O)(O)=S.O=[Re](=O)(=O)[O-].[Na+].
What is the InChIKey of sodium;oxido(trioxo)rhenium;sulfurothioic O-acid?
The InChIKey is JVMKHFTTXWORHH-UHFFFAOYSA-N. The full InChI is InChI=1S/Na.H2O3S2.4O.Re/c;1-5(2,3)4;;;;;/h;(H2,1,2,3,4);;;;;/q+1;;;;;-1;.
What are the key properties of sodium;oxido(trioxo)rhenium;sulfurothioic O-acid?
sodium;oxido(trioxo)rhenium;sulfurothioic O-acid has a molecular weight of 387.34 g/mol, XLogP of -4.87, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;oxido(trioxo)rhenium;sulfurothioic O-acid is sourced from PubChem (CID 23708886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).