C6H7N2NaS2 — CID 23710801
sodium 2,5-dimethyl-1H-imidazole-4-carbodithioate (PubChem CID 23710801) has the molecular formula C6H7N2NaS2 and a molecular weight of 194.26 g/mol. Its IUPAC name is sodium 2,5-dimethyl-1H-imidazole-4-carbodithioate.
| Compound Name | sodium 2,5-dimethyl-1H-imidazole-4-carbodithioate |
|---|---|
| PubChem CID | 23710801 |
| Molecular Formula | C6H7N2NaS2 |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | sodium 2,5-dimethyl-1H-imidazole-4-carbodithioate |
| SMILES | Cc1nc(C(=S)[S-])c(C)[nH]1.[Na+] |
| InChI | InChI=1S/C6H8N2S2.Na/c1-3-5(6(9)10)8-4(2)7-3;/h1-2H3,(H,7,8)(H,9,10);/q;+1/p-1 |
| InChIKey | FNXSNBLPGKSTPG-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|