C20H16NNaO7S — CID 23711702
sodium (2S,5R,6Z)-3,3-dimethyl-6-[2-(4-methyl-2-oxochromen-7-yl)oxy-2-oxoethylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23711702) has the molecular formula C20H16NNaO7S and a molecular weight of 437.41 g/mol. Its IUPAC name is sodium (2S,5R,6Z)-3,3-dimethyl-6-[2-(4-methyl-2-oxochromen-7-yl)oxy-2-oxoethylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6Z)-3,3-dimethyl-6-[2-(4-methyl-2-oxochromen-7-yl)oxy-2-oxoethylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23711702 |
| Molecular Formula | C20H16NNaO7S |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | sodium (2S,5R,6Z)-3,3-dimethyl-6-[2-(4-methyl-2-oxochromen-7-yl)oxy-2-oxoethylidene]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)/C=C3/C(=O)N4[C@@H]3SC(C)(C)[C@@H]4C(=O)[O-])ccc12.[Na+] |
| InChI | InChI=1S/C20H17NO7S.Na/c1-9-6-14(22)28-13-7-10(4-5-11(9)13)27-15(23)8-12-17(24)21-16(19(25)26)20(2,3)29-18(12)21;/h4-8,16,18H,1-3H3,(H,25,26);/q;+1/p-1/b12-8-;/t16-,18+;/m0./s1 |
| InChIKey | SQPKKXONQUDUGA-MWKKODDESA-M |
| XLogP | -2.25 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|