About methyl 3-amino-2,5-dichlorobenzoate
methyl 3-amino-2,5-dichlorobenzoate (PubChem CID 23714) has the molecular formula C8H7Cl2NO2
and a molecular weight of 220.06 g/mol. Its IUPAC name is methyl 3-amino-2,5-dichlorobenzoate.
Molecular Properties
| Compound Name | methyl 3-amino-2,5-dichlorobenzoate |
| PubChem CID | 23714 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | methyl 3-amino-2,5-dichlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)cc(N)c1Cl |
| InChI | InChI=1S/C8H7Cl2NO2/c1-13-8(12)5-2-4(9)3-6(11)7(5)10/h2-3H,11H2,1H3 |
| InChIKey | DTSSCQVCVYZGSI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-2,5-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-2,5-dichlorobenzoate?
The IUPAC name of methyl 3-amino-2,5-dichlorobenzoate (CID 23714) is methyl 3-amino-2,5-dichlorobenzoate.
What is the SMILES notation for methyl 3-amino-2,5-dichlorobenzoate?
The canonical SMILES for methyl 3-amino-2,5-dichlorobenzoate is COC(=O)c1cc(Cl)cc(N)c1Cl.
What is the InChIKey of methyl 3-amino-2,5-dichlorobenzoate?
The InChIKey is DTSSCQVCVYZGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO2/c1-13-8(12)5-2-4(9)3-6(11)7(5)10/h2-3H,11H2,1H3.
What are the key properties of methyl 3-amino-2,5-dichlorobenzoate?
methyl 3-amino-2,5-dichlorobenzoate has a molecular weight of 220.06 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-2,5-dichlorobenzoate is sourced from PubChem (CID 23714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).